10.00 g of Compound X with molecular formula C4H8 are burned in a constant-pressure calorimeter containing 50.00 kg of water at 25 °C. The temperature of the water is observed to rise by 2.151 °C. (You may assume all the heat released by the reaction is absorbed by the water, and none by the calorimeter itself.) Calculate the standard heat of formation of Compound X at 25 °C. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits.

10.00 g of Compound X with molecular formula C4H8 are burned in a constant-pressure calorimeter containing 50.00 kg of water at 25 °C. The temperature of the water is observed to rise by 2.151 °C. (You may assume all the heat released by the reaction is absorbed by the water, and none by the calorimeter itself.) Calculate the standard heat of formation of Compound X at 25 °C. Be sure your answer has a unit symbol, if necessary, and round it to 2 significant digits.

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter5: Thermochemistry

Section: Chapter Questions

Problem 5.63QE: A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form...

See similar textbooks

Similar questions

Under what circumstances is the heat of a process equal to the enthalpy change for the process?
Is the following reaction the appropriate one to use in determining the enthalpy of formation of methane, CH4(g)? Why or why not? C(g)+4H(g)CH4(g)
Give the definition of the standard enthalpy of formation for a substance. Write separate reactions for the formation of NaCl, H2O , C6H12O6, and PbSO4 that have H values equal to Hf for each compound.
The thermochemical equation for the burning of methane, the main component of natural gas, is CH4(g)+2O2(g)CO2(g)+2H2O(l)H=890kJ (a) Is this reaction endothermic or exothermic? (b) What quantities of reactants and products are assumed if H = 890 kJ? (c) What is the enthalpy change when 1.00 g methane burns in an excess of oxygen?
Gasohol, a mixture of gasoline and ethanol, C2H5OH, is used as automobile fuel. The alcohol releases energy in a combustion reaction with O2. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(l) If 0.115 g ethanol evolves 3.62 kJ when burned at constant pressure, calculate the combustion enthalpy for ethanol.
9.41 Under what conditions does the enthalpy change equal the heat of a process?
In a coffee-cup calorimeter, 150.0 mL of 0.50 M HCI is added to 50.0 mL of 1.00 M NaOH to make 200.0 g solution at an initial temperature of 48.2C. If the enthalpy of neutralization for the reaction between a strong acid and a strong base is 56 kJ/mol, calculate the final temperature of the calorimeter contents. Assume the specific heat capacity of the solution is 4.184 J/g C and assume no heat Joss to the surroundings.
A 0.470-g sample of magnesium reacts with 200 g dilute HCl in a coffee-cup calorimeter to form MgCl2(aq) and H2(g). The temperature increases by 10.9 C as the magnesium reacts. Assume that the mixture has the same specific heat as water and a mass of 200 g. (a) Calculate the enthalpy change for the reaction. Is the process exothermic or endothermic? (b) Write the chemical equation and evaluate H.
The Romans used calcium oxide, CaO, to produce a strong mortar to build stone structures. Calcium oxide was mixed with water to give Ca(OH)2, which reacted slowly with CO2 in the air to give CaCO3. Ca(OH)2(s) + CO2(g) CaCO3(s) + H2O(g) (a) Calculate the standard enthalpy change for this reaction. (b) How much energy is evolved or absorbed as heat if 1.00 kg of Ca(OH)2 reacts with a stoichiometric amount of CO2?