123 6. Make the molecular model for the [CoBr24] complex and answer the following questions. Use an octahedral "jack" for the Co, red for the Br, and white for the I. You may substitute colors for those that are stated if you run out of a given color. What is the name of the complex? What is the coordination number of the Co? What is the oxidation number of the Co? What is the shape of the complex? Sketch the complex: 6 Octahedal Try to construct a geometric isomer of the complex. Then try to superimpose the complex that you just made on the original. If the two are different, draw each complex and label each as cis- and trans- respectively. If they superimpose, write the word "superimposeable" in the space below. oline3 Construct a model of the mirror image of each of the geometric isomers sketched in the space above or of the single complex if geometric isomers do not exist. Sketch the appropriate mirror images. Try to superimpose the mirror images on to the original complex(es). Do they superimpose? Does the [CoBr214] complex demonstrate geometric isomers?

123 6. Make the molecular model for the [CoBr24] complex and answer the following questions. Use an octahedral "jack" for the Co, red for the Br, and white for the I. You may substitute colors for those that are stated if you run out of a given color. What is the name of the complex? What is the coordination number of the Co? What is the oxidation number of the Co? What is the shape of the complex? Sketch the complex: 6 Octahedal Try to construct a geometric isomer of the complex. Then try to superimpose the complex that you just made on the original. If the two are different, draw each complex and label each as cis- and trans- respectively. If they superimpose, write the word "superimposeable" in the space below. oline3 Construct a model of the mirror image of each of the geometric isomers sketched in the space above or of the single complex if geometric isomers do not exist. Sketch the appropriate mirror images. Try to superimpose the mirror images on to the original complex(es). Do they superimpose? Does the [CoBr214] complex demonstrate geometric isomers?

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter21: Transition Metals And Coordination Chemistry

Section: Chapter Questions

Problem 108IP: a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the...

See similar textbooks

Similar questions

Which of the following statement(s) is( are) true? a. The coordination number of a metal ion in an octahedral complex ion is 8. b. All tetrahedral complex ions are low-spin. c. The formula for triaquatrianuninechromiwn(III) sulfate is [Cr(H2O)3(NH3)](SO4)3. d. The electron configuration of Hf2+ is [Xe]4f126s2. e. Hemoglobin contains Fe3+.
a. In the absorption spectrum of the complex ion Cr(NCS)63, there is a band corresponding to the absorption of a photon of light with an energy of 1.75 104 cm-1. Given 1 cm1 = 1.986 1023 J, what is the wavelength of this photon? b. The CrNC bond angle in Cr(NCS)63 is predicted to be 180. What is the hybridization of the N atom in the Ncs- ligand when a Lewis acid-base reaction occurs between Cr3+ and NCs- that would give a 180 CrNC bond angle? Cr(NCS)63 undergoes substitution by ethylenediamine (en) according to the equation Cr(NCS)63+2enCr(NCS)2(en)2++4NCS Does Cr(NCS)2(en)2+ exhibit geometric isomerism? Does Cr(NCS)2(en)2+ exhibit optical isomerism?
What types of isomers are possible for the following compounds or complex ions? (a) K[Co(NH3)2Cl4] (b) Pt(en)Cl2 (square-planar) (c) [Co(NH3)5Cl]2+ (d) [Ru(phen)3]Cl3 (e) Na2[MnCl4] (tetrahedral) (f) [Co(NH3)5NO2)2+
Two different compounds are known with the formula Pd(py)2Cl2, but there is only one compound with the formula Zn(py)2Cl2. The symbol py is for pyridine, a mono-dentate ligand. Explain the differences in the Pd and Zncompounds.
Classify each ligand as monodentate, bidentate, and so on. (a) (CH3)3P (b) H2N(CH2)2NH(CH2)2NH2 (c) H2O