2-bromopentane is an optically active compound. Draw the two possible structures of optical isomer and label the chiral center with an asterisk (*) in each of the optical isomer structure.

Q: Is 2-methyl-2-butanol chiral

A: Organic nomenclature and chirality

Q: Give three different examples of chiral compounds that do not have an asymmetrically substituted…

A:

Q: How many chiral carbons are present in the structural formula for the open-chain form of d-mannose?…

A: Concept introduction: Chiral molecules: Molecule is said to be chiral if its mirror image is not…

Q: Draw the three isomers with the formula C 8 H 18 ?

A: Isomers are the ones which have the  same molecular formula but different structural arrangement.…

Q: 2-brokopentane is an optically active compound, draw the two possible structure of optical isomer…

A: 2-bromopentane has 1 chiral center (marked with *) now chiral center is that carbon centre which is…

Q: How many chiral carbons are in 2-bromo-2-chloro-3-methylpentane? (a) 0, (b) 1, (c) 2, (d) 3, (e) 4…

A:

Q: CH3 но -CH CH3 H3C 0-CH3 This compound has how many chiral carbons? 1 O 5 O 6 O 2 O 3

A:

Q: How many chiral carbon? Br 2 3 O 5 4.

A: If a carbon atom in the molecule is attached with four different groups, then the carbon is known as…

Q: Draw TWO (2) structural isomers of bromobutane

A:

Q: Name the isomers of the compound with the closed formula C4H9Cl. Which of these isomers can have a…

A: Given compound is :  C4H9Cl  Name the isomers of the compound with the closed formula C4H9Cl = ?…

Q: Identify the functional groups. Cl- OCH3

A: To identify the functional group in the given molecule

Q: "The cis isomer has two groups on the same side of the double bond" Define this ?

A: The isomer with the same substituents on the same side of the double bond is called cis isomer, a…

Q: Draw chiral molecules that meet the following descriptions: (a) A chloroalkane, C5H11C1 (b) An…

A: Str 1, 2 and 4 are chiral but str 2 i.e alkenes can't be chiral.

Q: DIA

A: The carbon which attached with four different type of group or atom are called chiral carbon.

Q: Draw the structural isomers of C2H4BrCl and identify which of them has a chiral center.

A:

Q: What is the mathematical relationship between the number of chiral carbons and the number of optical…

A: Compounds possessing identical molecular formula (same count of H, C, O etc atoms) but having…

Q: Indicate the chiral centers in the molecules.

A: The chiral centre or asymmetric centre:If the molecule contains a carbon atom attached with four…

Q: How many chiral carbon atoms are there in this molecule? a. 1 b. 2 c. 3 3. 4

A: The chiral carbon atom is that carbon atom which is joined by different four atoms or molecules.So,…

Q: CHO H- HO- H- HO- ČH2OH

A: A carbon is said to be chiral carbon when carbon attached to four different groups or atoms.

Q: Draw the structures of the 3 isomers of C8H18 that contain 3 methyl branches on the main chain, 2 of…

A: The given compound is C8H18. It gives 3 isomers that follows the given conditions which are it…

Q: Why can’t an organic molecule have the formula C2H7?

A: The bonding in main-group elements (especially carbon, nitrogen, oxygen, and halogens,) can be…

Q: Draw the structure of R-3-bromo-2-methylpentane. Clearly show the ranking of the groups on the…

A:

Q: chiral carbon atoms are

A:

Q: Explain Constitutional Isomers Versus Stereoisomers ?

A: Isomers are those compounds which have the same molecular formula but the arrangement of atoms are…

Q: Why do alkynes not show cis–trans isomerism?

A: Alkyne has triple bond  and number of alkyl groups that can be attached is 2, unlike alkenes where 4…

Q: How many chiral center, if any, would be formed in this structure?

A: Chiral carbon or Chiral center : A chiral carbon atom is a carbon atom that is attached to four…

Q: 4. (a) How many chiral carbons are present in the compound below? Mark the chiral carbons with an…

A:

Q: Draw the structure of the one tertiary (3°) alcohol with the molecular formula C6H₁40 that contains…

A:

Q: Define each term related to optical isomerism: enantiomers, chiral, dextrorotatory, levorotatory,…

A: Enantiomers: The isomers which are non-superimpossible mirror images of each other are called…

Q: How many chiral carbon atoms are present in the following compound? H3C- H3C

A: structure of Compound is given  Number of Chiral carbon atoms = ?

Q: 1. Carbon atoms always have how many covalent bonds? 2. Hydrogen atoms always have how many covalent…

A: The covalent bond can be defined as a chemical bond which involves sharing of electron pairs between…

Q: The chiral carbon atom is: a. A carbon atom that has a double bond b. A carbon atom that has no…

A: The answer is given as follows  A chiral carbon is that carbon which have four different group,…

Q: How many chiral carbon? CI CI O 2 O 3 5.

A: The number of chiral carbons in given compound has to be given.

Q: Explain why Chiral molecules are expected to interact with plane polarized light?

A: Chiral molecules are unsymmetrical molecules that is they don't possess any plane of symmetry and…

Q: H. |1 C=0 H C OH 3 CH2OH Number of chiral carbon atoms: Name of the structure

A: Given that : We have to determine the number of chiral carbon atoms in the following structure and…

Q: What is an isomer? Name the isomers of the compound with the closed formula C4H9CI. Which of these…

A: There are various organic compounds that look similar to each other in terms of their formula.…

Q: Is 3-chloro-3-methylhexane chiral?

A: Chiral means asymmetric in such a way that the structure and its mirror image are not…

Q: H.

A:

Q: 2. How many chiral carbon atoms are in the following compound? CH:(OH)CH(OH)CH(OH)CH(OH)CH;OH a) 1…

A: A chiral carbon atom or asymmetric carbon atom is one whose four valencies are occupied by four…

Q: How many chiral carbon atoms are in this molecule: CHO H- OH H- OH H- OH H- OH ČH2OH

A: Chiral carbon-  Chiral carbon or chiral center is the center in which carbon atom is attatched with…

Q: Which of the following compounds has a chiral carbon atom?

A: In organic chemistry, the chiral carbon is that tetrahedral carbon centre which are attached by four…

Q: How many chiral carbon atoms are there in the pictured molecule? H2N-CH-COH CH2CHCH3 CH3 O 2 O 5 O 4…

A:

Q: COOH H. OH CH3

A: Applying concept of chiral carbon.

Q: 5) Correctly name cach of the following organic compounds. Identify all chiral centers and indicate…

A: Given compounds,

Q: Examine the structure of PGF2a. Identify all chiral centers and all double bonds about which…

A:

Q: number of chiral carbon atoms in one molecule of the compound: НН ОН ... HOCH S-Ċ-Ċ

A: A catalyst is a species that increase the rate of reaction without getting consumed in a reaction.