In the following chemical reaction, what type of reaction is occurring? CH1206 + O2 → CO2 + H,0 + energy Oneutralization hydrolysis substitution oxidation/reduction dehydration synthesis (condensation)

In the following chemical reaction, what type of reaction is occurring? CH1206 + O2 → CO2 + H,0 + energy Oneutralization hydrolysis substitution oxidation/reduction dehydration synthesis (condensation)

General, Organic, and Biological Chemistry

7th Edition

ISBN:9781285853918

Author:H. Stephen Stoker

Publisher:H. Stephen Stoker

Chapter9: Chemical Reactions

Section: Chapter Questions

Problem 9.5EP: Write the chemical formulas for the products formed when each of the following hydrocarbons...

See similar textbooks

Related questions

Q: Identify the statements that tell the truth. 1. Organic compounds come only from living organisms 2.…

A: The true statement is given below -

Q: C12H22O11 + H2O → C6H12O6 What type of reaction is this? Is the lactose to glucose reaction a…

Q: Give the name or condensed structural formula, as appropriate: CH3CH2CH(C2H5)CH2CH2CH2CH3

A: The first and the foremost step while naming the IUPAC name of an organic compound is the…

Q: To what category of hydrocarbon does C8 H14 belong?

A: Given that, Hydrocarbon= C8H14

Q: Name one homogeneous catalyst used in hydrogenation of alkenes.

A: A catalyst is a substance which does not participate in the reaction but alters the rate of…

Q: b) CH-CH-CH-OH 5. Complete the following oxidation reactions for alcohols. Draw the structure of the…

A: These are the Reactions in Which alcohol group is oxidized to Ketone or aldehyde depending upon…

Q: 5. Esters, polyesters and fats all contain the ester linkage. Esters can be made from alcohols and…

A: When carboxylic acid react with alcohol in acidic conditions then formation of ester takes place…

Q: Write the equation for the oxidation of glucose (C6H12O6). What is the sum of the coefficients for…

Q: CH,OH O CH,OH Но ÓCH,CH, ΟΗ ΟΗ b. НОСН OCH,CH,CH, OH OH

A: The explanation is given below-

Q: Identify the reactant that gets oxidized in the following reaction 5C2O4^2- (aq)+ 2MnO4^-(aq)

A: oxidation is increase in the oxidation number reduction is decrease in oxidation number

Q: Which of these is/are not generally associated with anabolism? Condensation Reduction O Hydrolysis…

A: Anabolic reactions are endergonic reactions with synthesis new molecule via an available source of…

Q: Glucose,C6H12O6, is a simple sugar that the body metabolizes into two molecules of pyruvic acid,…

A: The molecule undergoes addition of oxygen atoms or removal of hydrogen atoms during the chemical…

Q: What is the structural formula of CH2CHNH2? Valence electrons?

A: Structural formula: Arrangements of atoms and bonds in a molecule are represented as structural…

Q: Give the name or condensed structural formula, as appropriate: CH3CH2CH(CH3)CH2CH(CH3)2

A: The given compound is in condensed structural form. The structure can be also be drawn as,…

Q: Give examples of some carbohydrate derivatives that contain amino groups, amides, or carboxylate…

A: When some reactant is added to any reactant then a new product is formed and the product obtained is…

Q: Which of the following could be produced by an incomplete combustion of a petrol?

A: Petrol is a combination of different liquid alkanes with the chemical formula CnH2n+2.

Q: Dynamite consists of nitroglycerine mixed with diatomaceous earth or cellulose. What is another name…

A: Dynamite consists of nitroglycerine mixed with diatomaceous earth or cellulose Another name of…

Q: With the catalyst AlCl3 present, which reactant is needed to convert benzene to ethylbenzene?

A: Friedel-Crafts Alkylation refers to the replacement of an aromatic proton with an alkyl group. This…

Q: Proteins are polymers of amino acids connected by a peptide linkage. What type of reaction forms the…

A: We have to predict type of reaction, functional group involved and formed.

Q: Describe the chemical structures of the initial reactants involved in Maillard browning in food.

A: The solution is shown below.

Q: Proteins have complex three-dimensional structures. These polymers are held into these specific…

Q: H H H NaOEt, EtOH EtO DEt NaOEt, E1OH NC CN NaOEt, ETOH

Q: Write the condensed structural formula for the product of the hydrogenation of 3-methyl-1-pentene.

A: Hydrogenation is a reduction of alkene in which hydrogen atom is added across the double bond of…

Q: What type of chemical reaction is this? CH3CH2OH(l) + NaNH2(aq)→CH3CH2ONa(aq)+ NH3(aq)

A: Ethanol + Sodium amide ----> Sodium ethoxide + Ammonia

Q: 1. LiAlH4 2. H₂O* NH₂

A: Dear student since you have asked multiple questions but according to guidelines we will solve 1st…

Q: Draw the organic products formed in attached reactions?

A: The product of the above reaction is given below,

Q: 4. Write the product(s) for the following condensation reaction: HO-P NH OH ОН ОН

A: This condensation reaction is an example of the formation of nucleotide. The reaction involves the…

Q: 1. Fill in the blanks with the major organic product or starting material(s) 1) Et,O (or THF) 2)…

Q: НО O: H2N Write each of the two different dipeptides that form from the condensation reaction…

Q: The peptide bond joining amino acids into proteins is a specific example of the . bond. amide…

A: Amino acids consists of Amino (-NH2) and Carboxylic (-COOH) functional groups. Proteins are…

Q: Select the functional group that is a meta-deactivating group. -OH O CH 3 Co 2H

A: The functional group/groups which withdraws electron density away from the benzene ring are called…

Q: 1)KMhO,OH OH 2) H30* HO.

A: Dihydroxylation reaction: KMnO4 oxidizes alkene to the diol. This is also called Baeyer test. The…

Q: what is the chemical reaction of C6H8O7 and H2O?

A: Given, C6H8O7 + H2O -------->

Q: write the product of the reaction

A: 1. Ester hydrolysis in acidic medium to give acid and alcohol 2. Amides upon hydrolysis to give…

Q: Chemistry What percent of the ThOD of glycine (C2H5NO2) is used for its carbonaceous oxygen demand?

A: Theoretical Oxygen Demand (THOD) is the ideal oxygen consumption for any compound to decompose into…

Q: 10. Which of the following is NOT a biological molecule? B. H2O A. CaH12Os C. CHO2 D. All of the…

Q: Starting from benzene synthesize the following compounds. Write the reagents and intermediate…

Q: Soil color that may indicate a high amount of organic material present. White Red Black…

A: Organic material (humus) content more than 60% corbon content. So it's colour ranges dark brown to…

Q: The compound molybdenum (VI) pyrophosphate contains

A: The layered structure of molybdenum pyrophosphate (δ-(MoO2)2P2O7) was synthesized by heating…

Q: tannins O cellulose galic acid O saponins

A: The Caffeine is a drug that stimulates the human brain and nervous system. The caffeine is an…

Q: . An unknown organic compound has the molecular formula CAH100. It resists oxidation and it can…

A: Note: According to our guidelines we are supposed to answer only one question. Kindly repost other…

Q: What is the main structural difference between amylose and amylopectin?

A: The joining of many glucose units by the glycosidic bonds produces biopolymeric material such as…

Q: During the process of neutralisation the product formed is always neutral Is the statement true or…

A: This given Statement is not correct ( means false ) for weak electrolyte ( weak acid or weak base )…

Q: Complete the following chemical reaction and indicate the products. COSO4 • H2O(s)

A: Given :- CoSO4.H2O(s)+ ∆ → To determine :- products of above reaction

Q: What substance does this monomer make? CH, -CH,-C3CH-CH,- u- O plastic O styrofoam O rubber Oprotein

A: The above structure is a monomeric unit of polymer.

Q: Draw beaker drawings for: H2O AIPO4

A: Beaker drawing represents the ionic compounds or electrolytes present in the beaker. The…

Q: 2. Describe the type of browning reaction and catalyst involved in the following equation: OH LOH 2…

Q: What are the balanced Chemical Equations for the Combustion of C6H6N2S(Methylimidazole-2-Thiol) and…

A: Combustion refers to burning of compounds in oxygen. The non-metals produce oxides upon combustion.…

Q: 3. Bromine gas (Br2) is bubbled through ethane (C,H,) gas at room temperature. The type of reaction…

A: Answer :- (f) Substitution…

Q: What organic family does CH3CH20CH2CH3 belong to? O Carboxylic acid O Alcohol Ether O Aldehyde

A: Given molecular formula: CH3CH2OCH2CH3. We have to find which class of compound it is among the…

Question

In the following chemical reaction, what type of reaction is occurring?
CH1206 + O2 → CO2 + H,0 + energy
Oneutralization
hydrolysis
substitution
oxidation/reduction
dehydration synthesis (condensation)

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

This is a popular solution!

SEE SOLUTION Check out a sample Q&A here

Step 1

VIEW

Step 2

VIEW

Trending now

This is a popular solution!

Step by step

Solved in 2 steps

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Organoboron, Organolithium, and Organozinc Compounds

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

Indicate whether or not each of the following chemical reactions represents a combustion reaction. a. 4Fe + 3O2 2Fe2O3 b. C2H6O + 3O2 2CO2 + 3H2O c. 4NH3 + 3O2 2N2 + 6H2O d. C + CO2 2CO
Which is the oxidizing agent in the combustion of methanol (CH3OH)? CO2 O2 O CH3OH
In which of the following reactions does the red atom undergo an oxidation? na → na+ (na atom → na+ ion) Cl → Cl– (Cl atom → Cl– ion) CH3CH2OH → CH3CHO (ethanol → acetaldehyde) CH3CHO → CH3COO– (acetaldehyde → acetic acid) CH2=CH2 → CH3CH3 (ethene → ethan
Write the combustion reaction of C6H14+O2—->CO2+H2O
Diiodine pentaoxide oxidizes carbon monoxide to carbon dioxide under room conditions, yielding iodine as the sec- ond product: 1,O3(s) + 5 CO(g) → L(s) + 5 CO2(g) This can be used in an analytical method to measure the amount of carbon monoxide in a sample of air. Determine the oxidation numbers of the atoms in this equation. Which species is oxidized and which is reduced?
CO2 + H2O→H2CO3 → HCO3– +H+ → CO2– +2H This chemical reaction can produce 1) a small number of hydrogen ions 2) a large number of hydrogen ions 3) a high pH value 4) anoxia
Write down a balanced chemical equation for the complete combustion of methanol CH3OH(I) to CO2(g) H2O(I)
Write the IUPAC name of the compound produced by this reaction: O + B₁₂ 1.
Which is the axidizing agent in the combustion of methanol? O CO O CHOH
Choose the answer that best fits the reaction type for the equation below. H2SO4 + Pb(OH)4 → Pb(SO4)2 + H2O formation double displacement O single displacement O hydrocarbon combustion decomposition
Decomposition Reactions Carbon Reduction Reactions 2 Ag₂O(s)→ 4 Ag(s) + O₂(g) 2 MgO(s) → 2 Mg(s) + O₂(g) 2 Al₂O3(s) → 4 Al(s) + 3 O₂(g) 2 Fe₂O3(s)- 4 Fe(s) + 3 O₂(g) 2 HgO(s) → 2 Hg(1) + O₂(g) 2 Cr₂O3(s) → 4 Cr(s) + 3 O₂(g) Temperature Clear Graph 300 K AH° AS° (kJ) (J/K.mol) +62.2 +132.7 +1202.4 +216.7 +3351.4 +546.8 +1648.4 +551.5 +181.7 +2269.4 +286.8 +548.4 AG°(kJ) -1000 0 1000 2000 3000 300 Temperature (K) 2000 The metals Mg and Al, like most metals in groups 1A, 2A, and 3A of the periodic table, cannot be obtained by chemical reduction with carbon at reasonable temperatures. What process is used to obtain these metals from their ores?
Name the major organic compound formed by the following reaction: OCH 3 x OCH 3 acid (hydrolysis)