Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCI, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.HE.), respectively. If an electrode has a potential of 0.852 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver-silver chloride electrode? E- 0.655 If an electrode has a potential of -0.120 V with respect to a silver-silver chloride electrode, what is the potential with respecto a S.H.E.? E- 0.077 If an electrode has a potential of -0.042 V with respect to a saturated calomel electrode (S.C.E.), what is the potential with respect to a SH.E.? E- 0.199 If an electrode has a potential of 0.029 V with respect to a silver-silver chloride electrode, what is the potential with respect to a S.CE? Incerret If an electrode has a potential of -0.012 V with respect to a S.C.E., what is the potential with respect to a sliver silver chloride electrode? Incerrect

Convert each of the potentials. The silver-silver chloride and calomel reference electrodes are saturated with KCI, resulting in cell potentials of +0.197 V and +0.241 V with respect to the standard hydrogen electrode (S.HE.), respectively. If an electrode has a potential of 0.852 V with respect to a standard hydrogen electrode (S.H.E.), what is the potential with respect to a silver-silver chloride electrode? E- 0.655 If an electrode has a potential of -0.120 V with respect to a silver-silver chloride electrode, what is the potential with respecto a S.H.E.? E- 0.077 If an electrode has a potential of -0.042 V with respect to a saturated calomel electrode (S.C.E.), what is the potential with respect to a SH.E.? E- 0.199 If an electrode has a potential of 0.029 V with respect to a silver-silver chloride electrode, what is the potential with respect to a S.CE? Incerret If an electrode has a potential of -0.012 V with respect to a S.C.E., what is the potential with respect to a sliver silver chloride electrode? Incerrect

Chemical Principles in the Laboratory

11th Edition

ISBN:9781305264434

Author:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Publisher:Emil Slowinski, Wayne C. Wolsey, Robert Rossi

Chapter32: Voltaic Cell Measurements

Section: Chapter Questions

Problem 2ASA

See similar textbooks

Similar questions

For each of the following reactions, determine the overall balanced electrochemical reaction, its standard electric potential, and the standard Gibbs energy of the reaction. aCo+F2Co2++2F bZn+Fe2+Zn2++Fe c Zn+Fe3+Zn2++Fe d Hg2++HgHg22+
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
The following cell was found to have a potential of —0.492 V: Ag|AgCl(sat’d)||HA(0.200 M),NaA(0.300 M)|H2(1.00 atm),Pt Calculate the dissociation constant of HA, neglecting the junction potential.
Halide ions can he deposited at a silver anode, the reaction being Ag(s) + X- AgX(s) +e- Suppose that a cell was formed by immersing a silver anode in an analyte solution that was 0.0250 M Cl-,Br-, and I -ions and connecting the half-cell to a saturated calomel cathode via a salt bridge. (a) Which halide would form first and at what potential? Is the cell galvanic or electrolytic? (b) Could I- and Br- be separated quantitatively? (Take 1.00 l0-5 M as the criterion for quantitative removal of an ion.) If a separation is feasible, what range of cell potential could he used? (c) Repeat part (b) for I- and Cl-. (d) Repeat part (b) for Br- and Cl-.
At what pH does Ecell = 0.00 V for the reduction of dichromate by iodide ion in acid solution, assuming standard-state concentrations of all species except H+ ion?
From the standard potentials Tl++eTl(s)E0=0.336V TlCl(s)+eTl(s)+ClE0=0.557V calculate the solubility product constant for TlCl.
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
The measurement of pH using a glass electrode obeys the Nernst equation. The typical response of a pH meter at 25 00C is given by the equation where contains the potential of the reference electrode and all other potentials that arise in the cell that are not related to the hydrogen ion concentration. Assume that = 0.250 V and that a. What is the uncertainty in the values of pH and [H+] if the uncertainty in the measured potential is 1 m V ( 0.001 V)? b. To what precision must the potential be measured for the uncertainty in pH to be 0.02 pH unit?
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?