Answered: For the reaction 5Ce4+ + Mn 2+ + 4H2 O…

For the reaction 5Ce4+ + Mn 2+ + 4H2 O → 5Ce3+ + MnO4- + 8H+ , given E0 (Ce4+ /Ce3+ ) = 1.70V,E0 (MnO4- /Mn2+ ) = 1.507V, calculate ΔG0 for this reaction ?

Chemistry: Principles and Practice

3rd Edition

ISBN:9780534420123

Author:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Publisher:Daniel L. Reger, Scott R. Goode, David W. Ball, Edward Mercer

Chapter18: Electrochemistry

Section: Chapter Questions

Problem 18.97QE

See similar textbooks

Related questions

Q: Classify the radicals into the appropriate categories. Primary Secondary Tertiary Allylic…

A: Radical : It is any atom/molecule/ion which has at-least one unpaired electron in it.SI.noType of…

Q: Only typed solution

A: The objective of the question is to calculate the change in entropy (ΔS) when one mole of an ideal…

Q: The carbon-14 activity in papyrus growing along the Nile River today is 231 decay events per…

A: We know that Radioactive decay follows 1st order kinetics.Integrated Rate law equation for 1st order…

Q: Predict the product of this organic reaction: 0 + OH P+H₂O Specifically, in the drawing area below…

A: When a carboxylic acid reacts with an amine, amide is formed. At first there will be an acid base…

Q: A molecule phosphoresces with a single peak wavelength of 700 nm. The single fluorescence peak is at…

A: The answer is given in attachment below.Explanation:Step 1:Step 2: Step 3: Step 4:

Q: What is the hybriziation of the carbon 1 atom

A: Hybridization is the concept of mixing atomic orbitals to form an equal number of hybrid orbitals…

Q: Be sure to answer all parts. Give the IUPAC name for the following compound. уж 2,2, tert-methyl 2-3…

Q: Iminodiacetic acid (IDA) is often used in ion exchange resins as a way to remove heavy metals from…

A: The formation constant for a reaction represents the equilibrium constant for the formation of a…

Q: How many moles of Ag are in 63.5 grams of Ag₂O?

A: The objective of this question is to calculate the number of moles of Silver (Ag) present in 63.5…

Q: Which of the following accurately describes the major species in solution at point C on the…

Q: 6. Use the following balanced equation to answer the questions. 2 Al(s) + 6 HCl(g) -> 3 H2(g) +2…

A: 2 Al(s) + 6 HCl(g) → 3 H₂(g) + 2 AlCl₃(aq)(a) First, we'll find the moles of Al reacting:Given mass…

Q: Benzoic acid, C6H5COOH, has a Ka = 6.3 x 10-5, What is the percent ionized in a 0.95 M solution of…

A: Final answer is given in explanation please see from there.Explanation:Approach to solving the…

Q: What is the major organic product of the following reaction? NH AICI NH HN HN HN IV

A: alkyl group can be added by an electrophillic aromatic substitution reaction called the…

Q: The reaction observed in the video, thedecomposition of hydrogen peroxide in the presence of iodide…

A: According to Steady state approximation, slowest step is the rate determining step because this step…

Q: You wish to know the enthalpy change for the formation of liquid PCl3 from the elements. P4(s)+6…

Q: 4. Draw the major product(s) for each reaction. Label all reactants and products (R,S,E,Z) when…

A: Given is organic reaction. The given reaction is Hoffman reaction. Amines undergo Hoffman reaction…

Q: 3. ( What structures correspond to theses peaks? Show your reason. OM m/z 97 m/z 85 m/z 73

A: Mass spectrometry is an important tool for the determination of the molecular mass of the compound…

Q: Question 1 How would you perform these two transformations using radical conditions in the key step?…

A: Glutamate can be converted to aspartate, glucose, and palmitate through various metabolic pathways.…

Q: What is the product of the following reaction? ROOR ? HBr

Q: Draw the major product of this reaction. Ignore inorganic byproducts. a

A: Organic reactions are the reactions in which organic reactants react with each other to produce…

Q: Lattice enthalpy for NaCl is +788 kJ mol¯¹ and AH¸ = −784 kJ mol¯¹. Enthalpy of Hyd solution of NaCl…

Q: Given the following visual of the reaction below, how many of each species will be in the products…

A: The objective of the question is to determine the number of each species in the products box on the…

Q: Draw step 3 of the mechanism. CH 3 CH3 H₂C- H₂C Step 5 CH 2 H3C CH3 CH3 -CH 3 O Incorrect. Which of…

A: In presence of NaOEt, carbonyl compound having enolisable alpha hydrogen undergoes enolate formation…

Q: STARTING AMOUNT Determine the number of moles in 4.21 x 103 molecules of CaCl2

A: The objective of the question is to find out the number of moles in a given number of molecules of a…

Q: Show how the dehalogenation of (1R,2R)-1,2-dibromo-1,2-diphenyl ethane with zinc affords…

Q: Consider the following reaction: 2 A (aq) + B (aq) C (aq) + D (aq) If the Kc for this equilibrium…

A: Equilibrium constant Kc for a reaction is defined as the product of the molar concentrations of the…

Q: A compound (C,H100) has the IR, DEPT, 13C NMR and H NMR spectra below. What is structure? Explain…

A: 13C NMR: Number of signals: it tells us about how many sets of carbons in different electronic…

Q: Please consider the reaction below. How many stereoisomeric products will be formed? NaBD4, D₂O

A: This is an example of the reduction of ketone to alcohol

Q: ntify the expected major product of the following reaction. NBS Δ ? Br. -Br Br -Br || ॥ IV V Br

A: 1. InitiationN-bromosuccinimide (NBS) produces small amounts of bromine (Br). Light then…

Q: Please help, i need fast solution . Please don't provide handwritten solution ...

A: The objective of this question is to calculate the pH of a buffer solution after the addition of a…

Q: Draw the products of this three-step synthesis. Br2 (1 equiv) CH3CO2H 1. (CH3CH2)2 Select to Draw…

A: In acidic medium, carbonyl compounds having enolisable alpha hydrogen undergo bromination reaction…

Q: Give the IUPAC name for the following compound.

A: IUPAC stands for the International Union of Pure and Applied Chemistry. It is an international…

Q: How many kJ of heat is needed to raise the temperature of 0.250 L of water in t liquid phase from…

A: Volume of water V = 0.250 LT1 = 24.6 oCT2 = 46.2 oC

Q: What is the IUPAC name for the compound shown? OHHHH H-C-C-c-c-C-O-H | | HH H H

A: IUPAC rule for carboxylic acid,1) Choose longest chain as parent chain.2) Numbering start from…

Q: 5) A photon of energy 12.1 eV absorbed by hydrogen atom, originally in the ground state, raises the…

A: The photon energy given is = 12.1 eVSo, the energy is = -13.6eVThe quantum number of the state is :

Q: propose a synthesis.

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: 1. Strong Base 2. CHзBr (1 equiv) Draw Product via Less Stable Intermediate + Draw Product via More…

A: Writing the products via less stable and more stable intermediate.

Q: When the following equation is balanced properly under acidic conditions, what are the coefficients…

A: The objective of this question is to balance the given redox reaction under acidic conditions and…

Q: What stereoisomers are possible from the following reaction? Select all that apply.

A: 1. The nucleophile or electron-rich species attacks the carbon attached to the leaving group from…

Q: The osmotic pressure of a saturated solution of CuBr at 25°C is 3 torr. What is the solubility…

A: The objective of the question is to calculate the solubility product of for the given conditions.

Q: Predict the product of the following Wittig reaction. Be sure your answer accounts for…

A: cyclopent-1-en-1-ylbenzene will formExplanation:

Q: CI N IZ

A: Given is organic synthesis reaction.The given starting compound is pyridine derivative.

Q: Draw C4H8Br2 that has the following 'H NMR spectrum: 1.97 (s, 3H), 3.89 (s, 1H). Hint: Draw C4H10…

A: Given :Molecule : Objective : Determine the structural formula.

Q: P.25 An HF molecule, with a bond length of 91.68 pm, absorbed on a surface rotates in two…

A: An 1H19F molecule with a bond length of 91.68 pm.It is absorbed on a surface that rotates in 2…

Q: Please don't provide handwritten solution...

A: The objective of the question is to complete the reaction mechanism for the distillation of ethane…

Q: Mg. ? 2.120

A: Grignard reagent on treatment with formaldehyde produces primary alcohol.

Q: Provide a synthesis of the following compound using the allowed starting materials: OH H of H OH H…

A: The question is based on the concept of organic synthesis.We need to synthesize the product using…

Q: Draw the enantiomer of the following compound:

A: Organic compounds can be defined as compounds that contain carbon and hydrogen atoms. We have been…

Q: Provide a curly arrow mechanism for this transformation, which is from a total synthesis of the…

A: Given is organic reaction.This is an example of ketal formation. In a ketal formation reaction a…

Q: A student needs to prepare a buffer made from HCO3 and with pH 6.690. If Ka for H2CO3 is 4.20 x…

A: Ka of H2CO3 = 4.2010-7pH = 6.690

Question

For the reaction 5Ce4+ + Mn 2+ + 4H2 O → 5Ce3+ + MnO4- + 8H+ , given E0 (Ce4+ /Ce3+ ) = 1.70V,
E0 (MnO4- /Mn2+ ) = 1.507V, calculate ΔG0 for this reaction ?

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step by step

Solved in 1 steps

SEE SOLUTION Check out a sample Q&A here

Similar questions

An aqueous solution of an unknown salt of gold is electrolyzed by a current of 2.75 amps for 3.39 hours. The electroplating is carried out with an efficiency of 93.0%, resulting in a deposit of 21.221 g of gold. a How many faradays are required to deposit the gold? b What is the charge on the gold ions (based on your calculations)?
Consider the reaction below at 25°C: 2MnO4(aq)+16H+(aq)+10Br(aq)2Mn2+(aq)+5Br2(l)+8H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 2.00 with all other ionic species at 0.100 M? (c) Is the reaction spontaneous at a pH of 5.00 with all other ionic species at 0.100 M? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M?
Consider the reaction low at 25°C: 3SO42(aq)+12H+(aq)+2Cr(s)3SO2(g)+2Cr3+(aq)+6H2O Use Table 17.1 to answer the following questions. Support your answers with calculations. (a) Is the reaction spontaneous at standard conditions? (b) Is the reaction spontaneous at a pH of 3.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (c) Is the reaction spontaneous at a pH of 8.00 with all other ionic species at 0.100 M and all gases at 1.00 atm? (d) At what pH is the reaction at equilibrium with all other ionic species at 0.100 M and all gases at 1.00 atm?
For each of the reactions, calculate E from the table of standard potentials, and state whether the reaction is spontaneous as written or spontaneous in the reverse direction under standard conditions. (a) Zn(s)+Fe2+(aq)Zn2+(aq)+Fe(s) (b) AgCl(s)+Fe2+(aq)Ag(s)+Fe3+(aq)+Cl(aq) (c) Br2(l)+2Cl(aq)Cl2(g)+2Br(aq)
For the following half-reaction, = 2.07 V: A1F63(aq)+3eAl(s)+6F(aq) Using data from Table 17-1, calculate the equilibrium constant at 25C for the reaction A13+(aq)+6F(aq)A1F63(aq)K=?
What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)
The standard potential, E, for the reaction of Zn(s) and Cl2(g) is +2.12 V. What is the standard free energy change, rG, for the reaction?
A current of 0.0100 A is passed through a solution of rhodium sulfate, causing reduction of the metal ion to the metal. After 3.00 hours, 0.038 g of Rh has been deposited. What is the charge on the rhodium ion, Rhn+? What is the formula for rhodium sulfate?
Galvanic cells harness spontaneous oxidationreduction reactions to produce work by producing a current. They do so by controlling the flow of electrons from the species oxidized to the species reduced. How is a galvanic cell designed? What is in the cathode compartment? The anode compartment? What purpose do electrodes serve? Which way do electrons always flow in the wire connecting the two electrodes in a galvanic cell? Why is it necessary to use a salt bridge or a porous disk in a galvanic cell? Which way do cations flow in the salt bridge? Which way do the anions flow? What is a cell potential and what is a volt?
For each reaction listed, determine its standard cell potential at 25 C and whether the reaction is spontaneous at standard conditions. (a) Mg(s)+Ni2+(aq)Mg2+(aq)+Ni(s) (b) 2Ag+(aq)+Cu(s)Cu2+(aq)+2Ag(s) (c) Mn(s)+Sn(NO3)2(aq)Mn(NO3)2(aq)+Sn(s) (d) 3Fe(NO3)2(aq)+Au(NO3)3(aq)3Fe(NO3)3(aq)+Au(s)
a Calculate K1, at 25C for phosphoric acid: H3PO4(aq)H+(aq)+H2PO4(aq) b Which thermodynamic factor is the most significant in accounting for the fact that phosphoric acid is a weak acid? Why ?