Q: H₂CO3 (carbonic acid) dissociates to give a bicarbonate and hydrogen ions, HCO3 and H+. Which…
A: When an acid (HA) dissociates in water, it produces hydrogen ions (H^+) and a conjugate base (A^-),…
Q: 11. 2. How much energy must be added to 50.0 grams of water to raise its temperature from 40.0°C to…
A: Given, mass of water= 50.0 g initial temperature, T1= 40.0 °C Final temperature, T1= 45.0 °C…
Q: e able to remove reactants/products from the equilibria by using the procedures in this experiment.…
A: Le Châtelier’s Principle states that a system at equilibrium will respond to any stress or…
Q: A chemistry graduate student is studying the rate of this reaction: 2C1,O, (g) ► 2Cl₂ (g) +50₂ (g)…
A: The given reaction is: 2Cl2O5g→2Cl2g+5O2g The rate law expression for the above reaction is:…
Q: Calculate the average atomic mass for this element. Is 121amu
A:
Q: engine.html?ClassID=984223440 How many isotopes are represented for the element in th mass spectrum?…
A: Isotopes are atoms of the same element that have the same atomic number (number of protons in the…
Q: Which of the following would be considered a basic solution? A. Solution with [OH-] = 3.8 x 104 M C.…
A: The solution which has pH value greater than 7 , is considered as a basic solution according to…
Q: What is the ratio of NH4* to NO₂ in O2-saturated water when the pH is 8.20 and the pE is 4.42?…
A: The question is based on pH of solution.
Q: Analyze the following reaction mechanism: 1. H₂O2 → H₂O + O 2. O + CF₂Cl2 → CIO + CF₂CI 3. CIO + O3…
A: Intermediates are those species are produced during the reaction and are not present before the…
Q: AH 390ledne non as to pulloonitul bonapig and not hudzoup galwollot di 40 17. Calculate the heat…
A: Answer-17 Condensation is a process in which substance changes its physical state form vapor to…
Q: Choose the correct ΔH0reaction for the reaction: 4 NH3(g) + 5 O2(g) → 4 NO(g) + 6 H2O(g) Compound…
A: The standard enthalpy change of reaction (ΔHoreaction) can be calculated by subtracting the sum of…
Q: 1. Show examples and structures the order of reactivity in SN2? 2. Show some SN2 reactions with…
A: According to the Bartley guidelines for the sub multipart, we can solve only first three questions.…
Q: The diene shown below will NOT react in a Diels-Alder reaction. Why not? Select one: A. The compound…
A: The Diels-Alder reaction is a cycloaddition reaction between a conjugated diene and a dienophile (a…
Q: Provide systematic name for the following compounds
A:
Q: A 1.615-g sample of benzoic acid, C7H6O2 (122.12 g/mol) was burned in a bomb calorimeter with excess…
A: Answer:- This question is answered by using the simple concept of calculation of molar heat of…
Q: A solution is made by dissolving 25.1 g of Ba(NO₂)₂ in 500.0 mL of water. Using Kb(NO₂⁻) = 2.2 ×…
A:
Q: Above is a lab i just did. I am struggling on putting a conclusion together wrapping it all up. Can…
A: The lab demonstrated the process of converting concentration units, such as from molarity to…
Q: Sucrose has the molecular formula If a sucrose sample C12H22O11. contains 5.0 x 1022 atoms of…
A: Given -> Molecular formula of sucrose = C12H22O11 Number of atoms of carbon = 5.0 × 1022 atoms…
Q: hich of the following components cannot be detected by gas chromatography? h) Volatile compounds
A: “Since you have posted a question with multiple sub-parts, we will solve the first three subparts…
Q: Give the diene and dienophile whose reaction at elecvated temperature produces the adduct shown…
A: We will try to cleave two probable sigma bond to get an idea about contributing moeity-
Q: 5. What reagents are needed to convert toluene (C,H,CH,) to each compound? a. C.H₂COOH c.…
A: Since you have posted a question with multiple sub-parts, we will solve the first three subparts for…
Q: By the Bransted-Lowry definition, acids are proton donors and bases are proton acceptors. By the…
A: Here we have 2 questions. First one is to identity lewis acid from the given reaction, Co2+ + 6NH3…
Q: Consider the following chemical equilibrium: 2 H₂(g) + O₂(g) 2H₂0 (1) Now write an equation below…
A:
Q: Allylamine, C3H5NH2, is a weak base. A 0.46 M aqueous solution of allylamine has a pH of 12.10. What…
A:
Q: Give the mechanism for the following reaction is HO H+ OH
A:
Q: In part 1 of this lab, you will be calculating A-H by conducting constant-pressure calorimetry…
A: Answer: When a m mass of a system gains Q heat and temperature change is ∆T then relation between…
Q: 4. Two containers are attached together as shown with a valve between the containers. The 26.0 L…
A: Given, Initially: when valve between the two container is closed. Note: 47.0 L container does not…
Q: Using VSEPR theory, predict the molecular geometry of the following molecules. a. H: P: H :C1: C. H…
A: The molecules given are a. PH2Cl b. HCOCl c. CH2Cl2 d. H2SiFCl
Q: yt
A: Given is organic synthesis reaction. In this reaction ketone is converted into amide. We can…
Q: 20. What would be the heat change needed to cool 44.5 grams of water from 105°C to 37.0°C? (ANS:…
A:
Q: 5. Consider the data showing the initial rate of a reaction (A products) at several different…
A: Given Initial rate of reaction A →Products with different concentration of reactant. [A] M…
Q: In the following equation for a chemical reaction, the notation (s), (I), or (g) indicates whether…
A:
Q: Suppose the formation of iodine proceeds by the following mechanism: step elementary reaction 1…
A: Overall reaction can be determined by adding all the steps of the mechanism of a reaction. Rate law…
Q: Pyrophosphoric acid and it's conjugate base, pyrophosphate, is abbreviated PP; and is formed by…
A: At pH 10.5, the solution is basic, which means the concentration of hydroxide ions (OH-) is high,…
Q: Which of the following sequences would successfully lead to the shown product? 1. II. III. O I. only…
A: The question is based on the concept of organic reactions. we need to identify the reaction in which…
Q: H H :O: :O: -CI: :CI: This is an E2 anti elimination. b Draw the organic product of the mechanism…
A: When POCl3 reacts with an alcohol it forms a new P-O bond which is more stable , then in presence…
Q: In a constant-pressure calorimeter, 70.0 mL of 0.300 M Ba(OH), was added to 70.0 mL of 0.600 M HCl.…
A: The question is based on the concept of calorimetry . whatever heat absorbed by solution is released…
Q: In parts 2, 3 and 4 of this lab, you will be conducting calorimetry experiments on neutralization…
A: In calorimeter, the heat of the reaction is calculated using the formula q=m×c×∆T where m is the…
Q: 9. The structure of nicotine is shown. Identify the delocalized electron pairs. A) On N¹ and N² both…
A: If lone pair are participate in resonance than lone pair are delocalised if the lone pairs cannot…
Q: ind ΔHrxn for the following reaction given the table below. N2O(g) + NO2(g) → 3 NO(g) Reaction…
A:
Q: Provide acceptable IUPAC systematic names for the following compounds: NH₂ O Na 'Br OH
A:
Q: -3 -2 -1 0 +1 +2 +3 +4 +5 +6 +7 구모 99 5NO 2 + 6H+ + 2MnO4 999 오,99 5NO3 + 2Mn+2 + 3H2O Reset
A: This question belong to periodic table and Redox reactions.
Q: Consider the following chemical equilibrium: 2 PbO (s) + O₂(g) 2 PbO₂ (s) Now write an equation…
A:
Q: Complete the table below by writing the symbols for the cation and anion that make up each ionic…
A: A chemical compound consists of two or more different elements which are bonded with each other…
Q: In part 1 of this lab, you will be calculating A-H by conducting constant-pressure calorimetry…
A: To calculate the enthalpy change we use the formula: Q = m x Cs x ∆T m = mass of the sample Cs =…
Q: if something is inductively favorable, is it an Electron withdrawing group?
A: Electron withdrawing groups :- The groups or atoms which pulls electron density towards itself…
Q: 4. Draw a picture showing the direction of heat flow in an endothermic reaction versus an exothermic…
A: The definitions are described below
Q: dentify ALL functional groups present in each molecule.
A: We have find out the functional group in the given compounds.
Q: the equilibrium constant for the reaction at 385 K is 2.78·10-4. Calculate the equilibrium constant…
A: Given: Equilibrium constant at 385 K = 2.78×10-4 ΔH° = 41 kJ mol-1 Temperature = 345 K
Q: How many moles of Ba(OH)2 are needed to react completely with 5.47 moles of H3PO4 according to the…
A: Given, 2H3PO4 +3Ba(OH)2 ---> Ba3(PO4)2+ 6H2O moles of H3PO4 reacts = 5.47 moles moles of Ba(OH)2…
States of Matter
The substance that constitutes everything in the universe is known as matter. Matter comprises atoms which in turn are composed of electrons, protons, and neutrons. Different atoms combine together to give rise to molecules that act as a foundation for all kinds of substances. There are five states of matter based on their energies of attraction, namely solid, liquid, gases, plasma, and BEC (Bose-Einstein condensates).
Chemical Reactions and Equations
When a chemical species is transformed into another chemical species it is said to have undergone a chemical reaction. It consists of breaking existing bonds and forming new bonds by changing the position of electrons. These reactions are best explained using a chemical equation.
Trending now
This is a popular solution!
Step by step
Solved in 2 steps with 1 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Dibenzalpropanone is a compound that can absorb UV rays and can be used as a sunscreen. Write down the reagents used to synthesize the compound dibenzalpropanone.Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Give IUPAC names for the following compounds:Alcohols undergo dehydration reactions in the presence of an acid catalyst. Which of the following compounds yields only a single alkene product upon dehydration?
- Draw the organic products formed when attached allylic alcohol A is treated with following reagent. [1] PBr3; [2] LiAlH4; [3] H2OMatch each reagent to the product that it forms. Multiple reagents may form the same product. нох Reagent Reagents SOCI2, pyridine: C CISO2CH3, pyridine: E HCI: A PCI 3: A A) B) "It "ft "bl H₂O D) E) F) پہلے علی علیہGive Introduction about Alcohols, ethers, and epoxides ?