Match each molecule/ functional group below to its most distinguishing feature. + wax A. COOH B. four fused ring structures * triacylglycerol C. polar head + two non polar tails + fatty acid D. glycerol + 3 fatty acids + ester Е. С-ОН + alcohol F. long chain carbon + alcohol * steroid G. * glycerophospholipid || -C- * carboxylic acid H. long chain carbon ending in COOH

Match each molecule/ functional group below to its most distinguishing feature. + wax A. COOH B. four fused ring structures * triacylglycerol C. polar head + two non polar tails + fatty acid D. glycerol + 3 fatty acids + ester Е. С-ОН + alcohol F. long chain carbon + alcohol * steroid G. * glycerophospholipid || -C- * carboxylic acid H. long chain carbon ending in COOH

Chemistry

10th Edition

ISBN:9781305957404

Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Publisher:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCoste

Chapter22: Organic And Biological Molecules

Section: Chapter Questions

Problem 118E

See similar textbooks

Similar questions

Fatty acids are carboxylic acids that have long hydrocarbon chains attached to a carboxylate group. How does a saturated fatty acid differ from an unsaturated fatty acid? How are they similar?
21-101 Glycerophospholipids tend to have both a positive charge and a negative charge in their hydrophilic portions. Does this fact help or hinder lipid packing in membranes? Explain.
Three examples of steroids are given. НО. Select aldosterone CH₂OH C=0 Draw the basic ring structure of a steroid. / |||||| Draw HO 0 H Rings CH3 CH3 ī CH3 T CHCH₂CH₂ CH₂CHCH 3 | CH CH3 cholesterol More CH3CH2 OH -CH₂CH3 tetrahydrogestrinone (THG), a "designer" synthetic steroid Erase
e X 1. During the hydrogenation of a cis-linked unsaturated fat, it will always convert to a trans fat when using a catalyst such as Nickel. True or False 2. Triglycerides always have three fatty acid chains linked to a glycerol group, and these fatty acids always have to have the same number of carbons in their
VMy C x YouTt X M Inbo X * Starfi X Chapter 01 - Funda... Mail - TABITA.WATS... 目Rea 1-36 Identify, by common name, fatty acids present in each of the following triacylglycerols. a. ÇH,-O-C-(CH2)16-CH3 CH-O-C-(CH2),-CH=CH-(CH2),-CH3 CH2-O-C-(CH2)12-CH3 b. CH2-O-C CH-O-C CH2-O-C ing 679% 包

1.Were the fatty acid propyl esters (biodiesel) formed in this reaction more or less polar than glycerol? Briefly explain Tricylglycerol + 1-propanol. = fatty acid propyl ester + glycerol 2.In your own words, explain why it is important to keep water out of this reaction? What would happen if water got into the reaction mixture? Support your answer with the chemical reaction. (Hint: Esterification and transesterification reactions are reversible)
7. Which of the following fatty acids would be a liquid at room temperature? Oa. CH3(HC=CH)5(CH2)9COOH Ob. CH3(CH2)19COOH Oc. CH3(CH2)22COOH d. more than one choice is correct
A lipid has the following structure: CH2-O-CH2-(CH2)16CH3 0 CH-O-C-(CH2)4CH=CHCH2CH=CH(CH2)7CH3 0 || CH2-O-C-(CH2)4CH-CHCH2CH=CH(CH2)7CH3 Which of the statements are true or false about the structure above Both this structure and a wax contain one or more carboxyl groups This lipid and a prostaglandin can both be hydrolyzed in acid to create fatty acids This lipid and a thromboxane can both be hydrolyzed in base to produce soaps Both this lipid and a terpene can be very hydrophobic molecules Based on its structural similarity to other lipids, this lipid most likely functions as a membrane component Both this structure and a wax contain one or more ester bonds This lipid and an arachidonic acid both contain glycerol and hydrocarbon chains Based on its structural similarity to other lipids, this lipid most likely functions as an energy storage molecule Both this lipid and a terpene can contain isoprene This lipid and a leukotriene are both polyunsaturated molecules Both this structure…
A protein is Multiple Choice о O O O о a polysaccharide. one of the units making up a nucleic acid. an aromatic hydrocarbon. a saturated ester of glycerol. a polymer of amino acids.
1.Triglycerides that are solids at room temperature are called 2.Compounds that differ in configuration around only one specific carbon atom with the exception of the carbonyl carbon are defined as 3.A multipurpose proteins with at least two identical proteins is referred to as 4. Compounds that are mirror images of themselves are referred to as 5. Triacylglycerol with two or three different fatty acids is called 6. In multisubunit protein with at least two identical proteins, the identical proteins are referred to as 7. A triacylgycerol in which all the three fatty acid groups are the same is called 8. The non-amino acid part of conjugate protein is usually called 9. A solution that contains a weak acid and it's conjugate base or a weak base and its conjugate acid that resist changes in pH upon addition of acid or base is called
What kind of fatty acid is the following structure? || HO-C-(CH2)14—CH3 monounsaturated Opolyunsaturated saturated
V F2 # 3 E 80 F3 What is the difference between integral and peripheral proteins? $ 4 F4 R A) Integral proteins are required for the cell to function, while peripheral proteins are accessory. B) Integral proteins are found on the outside of the cell, while peripheral proteins are found on the inside of the cell. C) Integral proteins extend through the lipid bilayer, and peripheral proteins are just on the surface of the inside or outside of the cell. Question 11 of 19 D) Integral proteins are found on the inside of the cell, while peripheral proteins are found on the outside of the cell. E) Integral proteins are channel proteins and peripheral proteins act as enzymes. % 5 F5 T <6 MacBook Air F6 Y & 7 ♡ F7 U * 8 DII F8 1 ( - 9 F9 0 O F10