Reaction: 2 ICI (g) 17.78 Cb (g). AH (kJ/mole) S° 247.551 116.135 223.066 (J/mole K) A. 0.0123 B. 0.949 C. 2.81 x 10 D. 81.1 Keywords: Gibbs free energy change, spontaneity, equilibrium constant, exter thermodynamically favorable, thermodynamically unfavorable Concepts: Gibbs Free Energy change, extent of reaction, thermodynamic favor

Reaction: 2 ICI (g) 17.78 Cb (g). AH (kJ/mole) S° 247.551 116.135 223.066 (J/mole K) A. 0.0123 B. 0.949 C. 2.81 x 10 D. 81.1 Keywords: Gibbs free energy change, spontaneity, equilibrium constant, exter thermodynamically favorable, thermodynamically unfavorable Concepts: Gibbs Free Energy change, extent of reaction, thermodynamic favor

Chemistry: An Atoms First Approach

2nd Edition

ISBN:9781305079243

Author:Steven S. Zumdahl, Susan A. Zumdahl

Publisher:Steven S. Zumdahl, Susan A. Zumdahl

Chapter16: Spontaneity, Entropy, And Free Energy

Section: Chapter Questions

Problem 5ALQ

See similar textbooks

Similar questions

A reaction has H298=100 kj/mol and S298=250 J/mol K. Is the reaction spontaneous at room temperature? If not, under what temperature conditions will it become spontaneous?
With regard to exercise 2.50, how accurate do you think your answer is, and why?
Given the following information at 25C, calculate G at 25C for the reaction 2A(g)+B(g)3C(g) Substance Hf(kJ/mol) S(J/molK) A(g) 191 244 B(g) 70.8 300 C(g) 197 164 a 956 kJ b 956 kJ c 346 kJ d 346 kJ e 1.03 103 kJ
Given that H f for HF(aq) is -320.1 kJ/mol and S for HF(aq) is 88.7 J/mol K, find Ka for HF at 25C.
Calculate the standard Gibbs free-energy change when SO3 forms from SO2 and O2 at 298 K. Why is sulfur trioxide an important substance to study? (Hint: What happens when it combines with water?)
What determines Ssurr for a process? To calculate Ssurr at constant pressure and temperature, we use the following equation: Ssurr = H/T. Why does a minus sign appear in the equation, and why is Ssurr inversely proportional to temperature?
Some say that the job of an engineer is to fight nature and the tendencies of entropy. (a) Does this statement seem accurate in any way? (b) How can any engineering design create order without violating the second law of thermodynamics?
On the basis of your experience, predict which of the following reactions are spontaneous. (a) CO2(s)CO2(g) at 25°C (b) NaCl(s)NaCl(l) at 25°C (c) 2NaCl(s)2Na(s)+Cl2(g) (d) CO2(g)C(s)+O2(g)
The free energy change, G, for a process at constant temperature and pressure is related to Suniv and reflects the spontaneity of the process. How is G related to Suniv? When is a process spontaneous? Nonspontaneous? At equilibrium? G is a composite term composed of H, T, and S. What is the G equation? Give the four possible sign combinations for H and S. What temperatures are required for each sign combination to yield a spontaneous process? If G is positive, what does it say about the reverse process? How does the G = H TS equation reduce when at the melting-point temperature of a solid-to-liquid phase change or at the boiling-point temperature of a liquid-to-gas phase change? What is the sign of G for the solid-to-liquid phase change at temperatures above the freezing point? What is the sign of G for the liquid-to-gas phase change at temperatures below the boiling point?
How does the second law of thermodynamics explain a spontaneous change in a system that becomes more ordered when that process is exothermic?
For the reaction CH3OH(l)+32O2(g)2H2O(l)+CO2(g) the value of G is 702.2 kJ at 25C. Other data are as follows: Hf (kJ/mol) at 25C S (J/molK) at 25C CH3OH(l) 238.7 126.8 H2O(l) 285.8 70.0 CO2(g) 393.5 213.7 Calculate the standard entropy, S, per mole of O2(g).
For the process A(l) A(g), which direction is favored by changes in energy probability? Positional probability? Explain your answers. If you wanted to favor the process as written, would you raise or lower the temperature of the system? Explain.