What is the IUPAC name for this compound? CH3 CH3 Selected Answer: [None Given] Answers: 2,5-dimethylcyclohexanone 1,4-dimethyl-2-cyclohexanone methylcyclohexanone cyclohexyl methyl ketone 1,4-dimethyl-3-cyclohexanone

What is the IUPAC name for this compound? CH3 CH3 Selected Answer: [None Given] Answers: 2,5-dimethylcyclohexanone 1,4-dimethyl-2-cyclohexanone methylcyclohexanone cyclohexyl methyl ketone 1,4-dimethyl-3-cyclohexanone

Organic Chemistry

9th Edition

ISBN:9781305080485

Author:John E. McMurry

Publisher:John E. McMurry

Chapter19: Aldehydes And Ketones: Nucleophilic Addition Reactions

Section19.SE: Something Extra

Problem 65AP: How would you synthesize the following compounds from cyclohexanone? a) 1Methylcyclohexene b)...

See similar textbooks

Related questions

Q: Draw the product, please ง ง L. CR,CH-CH-Mg Dr 2. H₂O 1. HO 2. PCC J. CH,MgBr 4. H,O LHCN KCN 2.…

A: We ahve to predict the products.

Q: Positive centromere staining is typically associated with which disease process? Question 8…

A: The question is asking which disease process is typically associated with positive centromere…

Q: Perform the conversions. 553.6 mmHg = atm 1.625 atm = Torr 403.5 kPa = atm 696.9 mmHg = Pa

A: The objective of the question is to convert the given pressure values from one unit to another. The…

Q: The pOH of a basic solution is 4.85. What is [OH⁻] in M?

A: The objective of the question is to find the concentration of OH- ions in a basic solution given the…

Q: Predict the major products of the following organic reaction: CN Δ ?

A: We have to predict the product of the given reaction.

Q: Predict the major product for the following reaction, include Stereochemistry of appropriat a. NaBH4…

A: The objective of the question is to predict the major product of a series of reactions involving…

Q: B. GIVE THE NUMBER OF STEPS IN YOUR MECHANISM To preview the image Click Here A. NaBH4 H EtOH OH OH.…

Q: C. 1. Hg(OAc)2/H₂O 2. NaBH4 d. 1. Excess LiAlH4 2. H3O+ e. OH PBг3

A: The question is based on organic reactions.We need to identify the product and explain its…

Q: When the following skeletal equation is balanced under acidic conditions, what are the coefficients…

A: Since,Redox reaction are those reaction in which oxidation as well as reduction both takes place…

Q: HCN is a weak acid (K₁ = 6.20 x 10-10), so the salt, KCN, acts as a weak base. What is the pH of a…

Q: Determine [OH−] of a solution that is 0.290 M in HCO3− . ( Ka1 for H2CO3 is 4.3×10−7 .)

A: For the given weak acid , dissociation constant Ka = 4.3 * 10-7First we have to calculate the H+…

Q: Question 6 CH3CH2CH2C CH + H₂O A. D. OH H₂SO₂ HgSO4 B. H E. None of the above What is the product of…

A: In this question alkyne has been converted into ketone.

Q: Calculating the pH of a weak acid titrated with a strong base 1/5 Izabella An analytical chemist is…

A: The volume of formic acid (H2CO2) = 156.9mL = 0.1569 LThe Molarity of formic acid(H2CO2) =0.9700MThe…

Q: When the following skeletal equation is balanced under acidic conditions, what are the coefficients…

Q: Use bond enthalpies in the table below to estimate AH for each of the following reactions. Average…

A: Given,The reactions:

Q: Question 5 Draw Zaitsev and Hofmann products that are expected when each of the following compounds…

Q: 1) consider the two halves of the naphthalene as separate-which is more reactive? What position in…

A: Given is organic reaction.The given reaction is electrophilic aromatic substitution reaction.Note:…

Q: Provide the systematic name of the cyclic monosaccharide shown here Be sure to include the…

A: Simplest carbohydrates cannot be hydrolyzed to smaller carbohydrates known as Monosaccharides.In the…

Q: Draw a structural formula for the more stable carbocation intermediate formed H3C C=CH2 + HBr H3C •…

A: Answer with explanation is provided in the image. Explanation:

Q: write the balanced equation for an acid base reaction that would produce each of the following…

A: An acidic solution and a basic solution react together in a neutralization reaction that forms a…

Q: Consider the following reaction:2NOBr(g) 2NO(g) + Br2(g)If 0.241 moles of NOBr, 0.262 moles of NO,…

A: The objective of the question is to calculate the equilibrium constant, Kp, for the given reaction…

Q: The green band consisted of chlorophylls. What does it tell you about the relative polarity of the…

A: Here, the elution behavior of compounds in the chromatography is influenced by the polarity of the…

Q: Predict the major product for the following reaction, include Stereochemistry of appropriate. a.…

A: Since you have posted a question with multiple sub-parts, we will solve first three sub-parts for…

Q: 20. What reactants would give the aldol condensation product shown? H

A: An aldol condensation is a condensation reaction in organic chemistry in which an enol or enolate…

Q: My dear hand written solution is not allowed.

A: Esters are the compounds which involve the -COO- as a functional group.. Esters are formed by the…

Q: An initial mixture of nitrogen gas and hydrogen gas is reacted in a rigid container at a certain…

A: Given:Reaction: 3 H2(g) + N2(g) ⇄ 2 NH3(g)At equilibrium, the concentrations are[H2] = 5.0 M[N2] =…

Q: Consider the following data on some weak acids and weak bases: acid base K K name formula name…

Q: Measured Mass of NaCI: 11.70 g Measured Volume of Water: 100.0 mL Answer each question with correct…

A: Information about the question

Q: Question 6. Predict the product of the following reaction and draw the mechanism. Includes all…

A: In electrophilic aromatic substitution, the hydrogen of the benzene is replaced by an electrophile.…

Q: What is the pH of a 4.1 × 106 M KOH solution?

A: The objective of this question is to calculate the pH of a solution of potassium hydroxide (KOH).

Q: (a) 6. Shown below are incomplete acid-base reactions. The molecules playing the role of acid and…

A: HereAcid - compounds can donate H+ ion or lone pair acceptorBase- compounds can accept H+ ion or…

Q: Organic chem 2 For the reaction: HCI 40° C a Draw the structure(s) of the major product(s) from…

A: In this reaction we need to find the product at 40 degree Celsius. At this temperature thermodynamic…

Q: When the following equation is balanced properly under acidic conditions, what are the coefficients…

A: The objective of the question is to balance the given redox reaction under acidic conditions and…

Q: Select the correct product for the oxidation reaction below. OH HO Na Cr₂O OH H₂SO

A: The oxidation of alcohol depends on the number of hydrogen atoms attached to the carbon atom that…

Q: Predict the major product for the following reaction. CN 1) EtMgBr 2) H3O+ ? 3) LiAlH4 4) H₂O+…

A: Given,The reaction is:

Q: Helium present inside a spherical balloon with a diameter of 7.5 m is found to be at a pressure of…

A: Given that,Diameter = 7.5 mPressure = 200 kPa.Surronding air temperature = 22 degrees Celsius.

Q: Which of the choices is NOT a resonace structure of the compound above? A B C D

A: The resonance structures are the structures that represent delocalization of electrons in a molecule…

Q: 4) Consider the following reactions that are either Diels-Alder or rely on a Diels-Alder step: a)…

A: b)Diels-Alder Reaction: Cyclopentadiene undergoes a Diels-Alder reaction with an appropriate…

Q: 10.51 Draw all stereoisomers formed in each reaction. a. Br₂ b. Cl₂ ن H₂O NBS d. DMSO, H₂O H₂O H2SO4

A: As images cannot be uploaded to this section, see below for the answers:Explanation:The answers are…

Q: Consider the following data on some weak acids and weak bases: acid base Ka K₁ name formula name…

A: The question is based on the concept of the pH of the solution.It is defined as a negative logarithm…

Q: Curved arrows are used to illustrate the flow of electrons. Using the provided starting structure,…

A: Alkyl magnesium halide is known as Grignard reagent and the reaction of Grignard reagent with ketone…

Q: What is the original molarity of a solution of ammonia whose pH is 10.54? Be sure your answer has…

Q: provide a detailed mechanism for the dehalogenation of meso-1,2 dibromo 1,2 diphenyl ethane. show…

A: Alkyl vicinal dihalides with the base like KOH undergo dehalogenation giving alkenes.The reaction…

Q: When the following equation is balanced properly under acidic conditions, what are the coefficients…

A: (a) Water (H2O) appears in the reactant with a coefficient of 1. (b) The number of electrons…

Q: Consider this organic reaction: ... -X° 口: 用 + Draw the major products of the reaction in the…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: For the given SN2 reaction, draw the organic and inorganic products of the reaction, and identify…

Q: V

A: The question is asking about the product formed when a compound undergoes two steps of reactions.…

Q: Predict the major product for the following reaction. H CH3 Br H + CH3SNa ? CH2CH3 CH3 CH3 CH3 CH3…

A: An arrow always depicts from a region of high electron density to low electron density ; that is…

Q: 1. Write a mechanism for the formation of oximes from aldehydes and hydroxylamine. 2. Reaction of…

A: The objective of the first part of the question is to describe the mechanism for the formation of…

Q: Draw the major product of this reaction. Ignore inorganic byproducts and the phthalic acid…

A: The reaction given is,

Concept explainers

Diol

In chemistry there are so many chemical compounds that have a hydroxyl group but a chemical compound having two hydroxyl groups (-OH) is termed as a diol. It also implies the presence of two alcohols whereas polyols contain two or more than two hydroxyl groups (-OH). Glycol or 1,2-diol is an aliphatic diol that has two alcohol groups on adjacent carbon atoms. In industries, the most commonly used diol is ethylene glycol.

Question

What is the IUPAC name for this compound?
CH3
CH3
Selected Answer: [None Given]
Answers:
2,5-dimethylcyclohexanone
1,4-dimethyl-2-cyclohexanone
methylcyclohexanone
cyclohexyl methyl ketone
1,4-dimethyl-3-cyclohexanone

Expert Solution

This question has been solved!

Explore an expertly crafted, step-by-step solution for a thorough understanding of key concepts.

SEE SOLUTION Check out a sample Q&A here

Step 1: Given information:

VIEW

Step 2: Identification of functional group:

VIEW

Step 3: Rule of IUPAC nomenclature:

VIEW

Step 4: Naming of the compound:

VIEW

Solution

VIEW

Step by step

Solved in 5 steps with 4 images

SEE SOLUTION Check out a sample Q&A here

Knowledge Booster

Learn more about

Need a deep-dive on the concept behind this application? Look no further. Learn more about this topic, chemistry and related others by exploring similar questions and additional content below.

Similar questions

What is product of the SN1reaction of 4-bromo-3,3-dimethylhexane with methanol (CH3OH) Select one: a. 3,4-dimethyl-3-methoxy-hexane b. 3,3-dimethyl-3-methoxy-hexane c. 4,4-dimethyl-3-methoxy-hexane d. 3,4-dimethyl-3-hexanol e. 3,4-dimethyl-4-methoxy-hexane
A Grignard reagent is made with the given bromoalkane. Draw the final product when the Grignard reagent reacts with the given compound followed by workup with H3O+. i) 1-bromo-3,3-dimethylbutane + 3-methylbutanal ---->ii) 1-bromo-3,3-dimethylbutane + butanoic acid. ---->iii) bromocyclopentane + cyclopentanone. ---->Iv) 7-bromo-4-methyl-2-heptanone (intramolecular rxn) ---->
Which of the following reactants would give 4-methylcyclohexanol as one of it's products? Select one: a.None b.5 methyl cycohexene c.4 methyl cycohexene d.3 methyl cycohexene e. 2 methyl cycohexene
What product is formed when 3-methyl-2-cyclohexenone reacts with each of the following reagents? a. CH3MgBr followed by H3O+ b. (CH3CH2)2CuLi followed by H3O+ c. HBr d. CH3CH2SH
What is the correct name for the molecule below? A. 6-bromo-3-hydroxybenzaldehydeB. 4-bromo-3-methanoylphenolC. 3-hydroxy-6-bromobenzaldehydeD. 2-bromo-5-hydroxybenzaldehydeE. o-bromo-m-hydroxybenzaldehyde
What the correct IUPAC name for the compound shown? CH2 I CH3-C-CH-CH2-CH3 I Br What the correct IUPAC name for the compound shown? CH3-CH2-CH-CH2-CH3 I CH2OH What the correct IUPAC name for the compound shown? CH3 I CH3-O-CH2-CH2-CH-CH3
How would you synthesize the following compounds from cyclohexanone? a) 1Methylcyclohexene b) 2Phenvlcyclohexanone c) cis1, 2Cyclohexanediol d) 1Cyclohexylcyclohexanol
The IUPAC name of the CORRECT answer in Q45 above is? a. 4-Pyridyl phenyl ketone b. Diphenyl ketone c. Cyclohexyl phenyl ketone d. Cyclohexyl benzoate
An unknown compound (whose molecular formula is C5H8O) shows IR absorption at 3600 and 3300 cm^-1. It’s ^1H-NMR spectrum contained singlets at delta 1.5, 2.2, and 2.9 (broad) ppm, in the ratio 6:1:1. Draw the structure for the unknown compound.
De los siguientes compuestos señale los que están correctamente nombrados CH3CH2CH2CH2CHO : 1-PENTANOL CH3CH2CH(CH3)CH2CH2CHO : HEPTANAL CH3CH(CH3)CH2CH(CH3)CH2CHO :3,5-DIMETILHEXANAL CH3CH2CH=CHCH2CHO : 3-HEXENAL
What is the product of the SN2 reaction of (R) 3-bromo-2-methylhexane with CH3CO- Select one: a. (S) 2-methyl-3-ethoxy-hexane b. (S) 2-methyl-2-ethoxy-hexane c. (S) 3-methyl-2-ethoxy-hexane d. (S) 2-methy-3-hexanol e. (R) 2-methy-3-hexanol
What product is formed when 2-methylbut-2-ene is treated with HI? 2-Iodo-3-methylbutane 1-Iodo-2-methylbutene 3-Iodo-2-methylbutane 2-Iodo-2-methylbutane