Write the obtainment of cinnamic acid (3-phenylpropenoic acid) using benzaldehyde and other necessary reagents, showing the reaction machinery.
Q: Using curved arrows to symbolize the flow of electrons, write a detailed stepwise mechanism for the…
A: The acid catalysed reaction of a ketone with an alcohol gives the formation of hemi-acetals which…
Q: 1. Illustrate a balanced chemical equation to synthesise aldehyde/ketone from the selected organic…
A:
Q: Write equations for the preparation of n-pentane from a. n-pentyl bromļde b. sec-pentyl bromide…
A: We have to write for the preparation n-pentane from the following given compounds as follows in step…
Q: Use retrosynthetic analysis to develop a synthesis of 2-phenyl-2-butanol from benzene and 2-butyne…
A: Retrosynthesis is a method of organic chemistry which is used to plan the synthesis of an organic…
Q: How to do a structural equation for the addition of pyridinium tribromide to trans-cinnamic acid?…
A: In this question, we want to write structural equation for Reaction between trans-cinnamic acid and…
Q: Write the mechanism of acid dehydration of ethanol to yield ethene.
A: Ethanol is an alcohol with formula CH3CH2OH. Since there is lone pair electrons on O. Hence it will…
Q: Write the synthesis of the following compound, starting with 2-methylpropene (isobutylene) and using…
A: In this question, we will Synthesis these three given Product from the starting material…
Q: Briefly describe the process of Fischer esterification of methyl salicylate.
A: Answer - Fischer esterification - Fischer Esterification is an organic reaction which is employed…
Q: Explain why it is possible to separate a mixture of p-nitrobenzoic acid and ethyl phenyl ether…
A: We are given a mixture of p-nitrobenzoic acid and ethyl phenyl ether, and we have to separate this…
Q: Write out a detailed stepwise mechanism for the esterification of Isopentyl propionate…
A: Condensation of Carboxylic acid and Alcohol is called as esterification reaction.
Q: Write a complete equation for the reaction between molecule H and 1- butanethiol in the presence of…
A:
Q: llustrate drawings for preparation of p-Nitroaniline.
A: Answer -
Q: Beginning with the correct organic halide and benzophenone show how one would prepare…
A:
Q: Write down the process scheme followed in caffeine isolation.
A: Isolation process
Q: Synthesize 2-Methyl-4-heptanone from 2-methyl-1-propanol and butanal using the organic or inorganic…
A: Here we have to synthesize 2-methyl-4-heptanone from 2-methyl-1-propanol and butanal and other…
Q: What happens if water is added during the Methyl Benzoate nitration? Why is methyl m-nitrobenzoate…
A:
Q: Write a note on HNO, availability, preparation and reaction with aniline.
A: HNO2 Availability : Nitrous acid is a weak monobasic acid. It is very unstable. It is only…
Q: How could you separate a mixture of ethanol, 1-pentanol and 1-octanol. Discuss the steps in your…
A: Fractional distillation is a type of distillation which involves the separation of miscible liquids.…
Q: Show the product formed as a result of the reaction between propanoic acid and benzylalcohol in an…
A: The reaction of an alcohol with acid leads to the formation of an ester molecule. The reaction is…
Q: Show how to convert 1-bromopentane to the compound using a lithium diorganocopper (Gilman)…
A:
Q: (a) 3-Methyl-2-pentanone is condensed with acetophenone in alkaline medium an
A: Since, you have asked multiple question, we will solve the first question for you. If you want any…
Q: 1. Illustrate a balanced chemical equation to synthesise aldehyde/ketone from the selected organic…
A:
Q: When separating the two products (benzoic acid and benzyl alcohol) in the Cannizzaro reaction, you…
A: Cannizaro reaction is a type of reaction in which aldehyde or ketone without alpha hydrogens react…
Q: TOPIC: Ester Synthesis via Nucleophilic Acyl Substitution Write the chemical equation involved in…
A: neutralization of acids
Q: Write step by step the synthesis steps of 3,3-dimethyl-2-pentanol compound by grignard method using…
A: In order to synthesize 3,3-dimethyl-2-pentanol, first we have to find the suitable reactants. This…
Q: Write the chemical reaction for the preparation of 2-Phenyethanol using a suitable Grignard reagent.
A: Bromobenzene on reacting with Mg/ether produces benzene Grignard reagent. The chemical reaction is…
Q: As a group, use your knowledge of acid-base extraction to come up with a plan to separate the…
A: The amine functional group is depicted as R-NH2, where R can be an alkyl or aryl group. When R is an…
Q: A student decided to run the esterification reaction between p-toluic acid (p-methylbenzoic) and…
A: Esterification reaction occurring between p-methylbenzoic acid and ethanol is:
Q: What conditions (temperature, catalysts, etc.) needs 6-Mercaptohexanoic acid to form starting from…
A: 6-Mercaptohexanoic acid forms a self-assembled monolayer, this mono polymer is used to cap a variety…
Q: Show the chemical equation of N,N- Dimethyl aniline reacts with Diazotized Sulfanilic acid to form…
A: Reaction : When Diazotised sulphanilic acid react with N,N-dimethylaniline, it is first…
Q: What would be the products of reaction of hydrogen bromide with 2-propoxybutane? • Name them using…
A: Ether reacts with hydrogen halide to form alcohol and alkyl halide. The reaction proceeds by the…
Q: 1) Discuss three methods that can be utilised to synthesise n – heptane in the laboratory.
A: preparation n heptane ;
Q: 5-bromoacetylsalicylic acid melts at 60 °C and is inert and almost insolube in water at room…
A:
Q: oxidation
A:
Q: Given a mixture of benzoic acid, 2-naphthol and p-dimethoxybenzene in t-butyl methyl ether. Using…
A: The given mixture is a ternary mixture of benzoic acid, 2-naphthol and p-dimethoxybenzene.
Q: Write a mechanism for the acid-catalyzed esterification of acetic acid with isopentyl alcohol.
A: This acid catalyzed estrification reaction is highly reversible, because carboxylic acids are as…
Q: Write the reaction between Phthalic Anhydride and Resorcinol to produce Fluorescein
A: Fluorescein is produced by the reaction of Phthalic Anhydride and Resorcinol. The reaction proceeds…
Q: Explain why we speak of acidic hydrolysis of an ester as acid-catalyzed, but of basichydrolysis as…
A: The substances which alters the rate of reaction without getting consumed in it are termed as…
Q: How would you separate toluene (C6H5CH3), benzoic acid (C6H5CO2H), and aniline (C6H5NH2) by an…
A: The solvent extraction method should be adopted to separate the three components present in the…
Q: Show how you would use extractions with a separatory funnel to separate a mixture of the following…
A:
Q: Provide the equation to the Esterification reaction below. Mix 3 mL of ethyl alcohol, 1 mL of…
A: Equation of Esterification
Q: 1. Explain what will happen to the (i) yield and (ii) purity, of aspirin if the following steps were…
A: Aspirin is a drug used for pain, fever and inflammation. Aspirin is a derivative of salicylic acid,…
Q: where you have to construct the carbon chain. c) Write out 3 preparations of 2-methylpropanoic acid,…
A: The answer is as follows:
Q: For the oxidation of side chain benzene derivatives, the oxidizing agent frequently used is KMnO4.…
A: Percentage yield of a product is more if only one product is formed. If a mixture of products are…
Q: What could be a potential use of adipic acid? A) Not much, adipic acid is a 1,6-dicarboxylic acid,…
A:
Q: Explain the purpose of the following steps, write the equation for the rection when applicable. .…
A: 2,4-DNP test is used in this case. 2,4-dinitrophenylhydrazine and semicarbazide are used to identify…
Q: Write out the stepwise mechanism, including proper arrow-pushing, for the reaction of toluene with…
A: Iodination of Toluene:
Q: Show how you could prepare 4-bromopyridine from 4-aminopyridine. Write the synthesis.
A: The conversion of 4-amino pyridine to 4-bromipyridine is needed to be shown. Since you have asked…
Q: Propose a method to separate a mixture containing phenol, benzoic acid, naphthalene, and…
A: The given 4 compound can be separated using acid base extraction Acid base extraction is used to…
Q: Write a flow chart for the separation of p-phenylphenol from naphthalene. Use structures to show how…
A:
Write the obtainment of cinnamic acid (3-phenylpropenoic acid) using benzaldehyde and other necessary reagents, showing the reaction machinery.
Step by step
Solved in 3 steps with 3 images
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l)CH3CH2CH2CO2H(l)+CH2CH3OH(l)⟶H+CH3CH2CH2CO2CH2CH3(l)+H2O(l) A chemist ran the reaction and obtained 5.40 g of ethyl butyrate. What was the percent yield, The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.45g of butanoic acid and excess ethanol?Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.45 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. A chemist ran the reaction and obtained 5.50 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 8.45 gg of butanoic acid and excess…Ethyl butyrate, CH3CH2CH2CO2CH2CH3CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.30 gg of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%% yield? Express your answer in grams to three significant figures. Part B A chemist ran the reaction and obtained 5.95 gg of ethyl butyrate. What was the percent yield? Express your answer as a percent to three significant figures. Part C The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0%% yield. How many grams would be produced from 7.30 gg of…
- Upon completion of a chemical reaction, you find you have a mixture of benzoic acid and ethyl benzoate. Propose a procedure to separate the ethyl benzoate from the mixture. You should look up the structures of benzoic acid and ethyl benzoate.Prepare CH3COOC2H5, ethyl acetate, using ethyl alcohol. Write the chemical reaction. The pain reliever acetaminophen is produced by reacting 4-aminophenol with acetic anhydride. Outline a synthesis of acetaminophen from 4-aminophenol including any needed inorganic reagents.Synthesize 2-hydroxypropanoic acid from ethanol
- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l). The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 8.50 gof butanoic acid and excess ethanol? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Given 8.50 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100%yield? Express your answer in grams to three significant figures.Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) a) Given 7.70 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield? b) A chemist ran the reaction and obtained 5.25 g of ethyl butyrate. What was the percent yield? c) The chemist discovers a more efficient catalyst that can produce ethyl butyrate with a 78.0% yield. How many grams would be produced from 7.70 g of butanoic acid and excess ethanol?
- Prepare ehtyl methyl ketone from propanal (give reagent, reaction condition and reaction type)The ketone 2-heptanone has been identified as contributing to the odor of a number of dairy products, including condensed milk and cheddar cheese. Describe the synthesis of 2-heptanone from acetylene and any necessary organic and inorganic reagents.Why can’t 2-methyl-2-propanol be prepared by the reduction of a carbonyl compound?