Concept explainers
(a)
Interpretation:
IUPAC name for the given compounds has to be given.
Concept Introduction:
Any organic molecule can be named by using certain rules given by IUPAC (International Union for Pure and applied chemistry). IUPAC name consists of three parts in major namely Prefix suffix and root word.
Prefix represents the substituent present in the molecule and its position in the root name.
Suffix denotes the presence of
Root word represents the longest continuous carbon skeleton of the organic molecule.
If the compound has a unsaturated bond present in it, then the position of the unsaturated bond is mentioned in the IUPAC name itself.
(b)
Interpretation:
IUPAC name for the given compounds has to be given.
Concept Introduction:
Any organic molecule can be named by using certain rules given by IUPAC (International Union for Pure and applied chemistry). IUPAC name consists of three parts in major namely Prefix suffix and root word.
Prefix represents the substituent present in the molecule and its position in the root name.
Suffix denotes the presence of functional group if any in the molecule. It can be an alkene, alkyne, alcohol, carboxylic acid, alcohol etc.
Root word represents the longest continuous carbon skeleton of the organic molecule.
If the compound has a unsaturated bond present in it, then the position of the unsaturated bond is mentioned in the IUPAC name itself.
(c)
Interpretation:
IUPAC name for the given compounds has to be given.
Concept Introduction:
Any organic molecule can be named by using certain rules given by IUPAC (International Union for Pure and applied chemistry). IUPAC name consists of three parts in major namely Prefix suffix and root word.
Prefix represents the substituent present in the molecule and its position in the root name.
Suffix denotes the presence of functional group if any in the molecule. It can be an alkene, alkyne, alcohol, carboxylic acid, alcohol etc.
Root word represents the longest continuous carbon skeleton of the organic molecule.
If the compound has a unsaturated bond present in it, then the position of the unsaturated bond is mentioned in the IUPAC name itself.
(d)
Interpretation:
IUPAC name for the given compounds has to be given.
Concept Introduction:
Any organic molecule can be named by using certain rules given by IUPAC (International Union for Pure and applied chemistry). IUPAC name consists of three parts in major namely Prefix suffix and root word.
Prefix represents the substituent present in the molecule and its position in the root name.
Suffix denotes the presence of functional group if any in the molecule. It can be an alkene, alkyne, alcohol, carboxylic acid, alcohol etc.
Root word represents the longest continuous carbon skeleton of the organic molecule.
If the compound has a unsaturated bond present in it, then the position of the unsaturated bond is mentioned in the IUPAC name itself.
Want to see the full answer?
Check out a sample textbook solutionChapter 23 Solutions
General Chemistry - Standalone book (MindTap Course List)
- What is the IUPAC name of the following compound? CH₂CCH₂CH₂CH3arrow_forwardWrite the correct IUPAC names for the following organic compounds A) CH3CH2CCH2CH3CH3CH2CH2CHCH3CH3 B) CH3CH2CHCH3CHCH3CH2CHCH2CH3CH2CH3arrow_forwardProvide the IUPAC names for the following compounds. 1. CH3 CH3 CH3CHC=CCHCH3 2. CH3 CH3CH2CC=CCHCH2CH3 CH3 3. CH3 CH3 CH3CH2CC=CCHCH3 ČH3 4. CH3CH=CHCH=CHC=CCH3 5.arrow_forward
- The following names are incorrect by IUPAC rules. Determine the correct IUPAC name for each compound. a. 2-Methyl-4-pentene b. 3-Methyl-2,4-pentadiene c. 3-Methyl-3-cyclopentene d. 1,2-Dimethyl-3-cyclohexenearrow_forwardGive the IUPAC name of the compound below. CH3CH2CHCH2CHCH3 CH3 CH2CH3arrow_forwardWhat is the IUPAC name of the following compound? OH CH3CH₂CCH₂CH3 CH₂CH3arrow_forward
- Give IUPAC names for the following compounds. a), b) CH₂CH₂CH3 -1 CH3CHCH₂CCH₂CH3 CH3 CH3 CH₂CH3 CH3 CH3CH₂CHCH₂CH₂CHCH₂arrow_forwardGive the IUPAC name for the organic compound shown here: CH3CHBrCH(CH3)CH2CH3arrow_forwardb C OH CH3CHCH₂CH₂CH3 IUPAC name is IUPAC name is CH₂CH₂CH₂CH₂CH₂-OH ၄။ CH3CHCHCH₂-OH CI IUPAC name isarrow_forward
- Organic And Biological ChemistryChemistryISBN:9781305081079Author:STOKER, H. Stephen (howard Stephen)Publisher:Cengage Learning,General, Organic, and Biological ChemistryChemistryISBN:9781285853918Author:H. Stephen StokerPublisher:Cengage Learning
- Chemistry for Today: General, Organic, and Bioche...ChemistryISBN:9781305960060Author:Spencer L. Seager, Michael R. Slabaugh, Maren S. HansenPublisher:Cengage Learning