Concept explainers
(a)
Interpretation:
The potential energy diagram for the given reaction has to be given with appropriate labels.
Concept introduction:
Activation energy
(b)
Interpretation:
The plausible structure for the transition state for the given reaction has to be drawn.
Concept introduction:
Transition state: Transition state is an intermediate state of a particular reaction with highest energy value. At the transition state it has a particular configuration where bond breaking and formation are showed by dashed lines.
Activation energy
Want to see the full answer?
Check out a sample textbook solutionChapter 12 Solutions
General Chemistry: Atoms First
- xplain why aluminum cans make good storage containers for soft drinks. Styrofoam cups can be used to keep coffee hot and cola cold. How can this be?arrow_forwardCobalt(II) chloride hexahydrate, CoCl26H2O, is a bright pink compound, but in the presence of very dry air it loses water vapor to the air to produce the light blue anhydrous salt CoCl2. Calculate the standard free-energy change for the reaction at 25C: CoCl26H2O(s)CoCl2(s)+6H2O(g) Here are some thermodynamic data at 25C: What is the partial pressure of water vapor in equilibrium with the anhydrous salt and the hexahydrate at 25C? (Give the value in mmHg.) What is the relative humidity of air that has this partial pressure of water? The relative humidity of a sample of air is Relativehumidity=partialpressureofH2O(g)inairvaporpressureofwater100 What do you expect to happen to the equilibrium partial pressure over the hexahydrate as the temperature is raised? Explain.arrow_forwardWhat is U for the following reaction at 25C? 2H2(g)+O2(g)2H2O(l)arrow_forward
- Identify the type of reactions below as endo or exothermic and give reason. 1) 2 SO, (g) → 2 S (s) + 2 0, (g) + 376 kJ 2) 2 So, (g) + 198 kJ → 2 SO, (g) + O, (g) 3) 2 H,0 (g) + 572 kJ → 2 H, (s) + O, (g) 4) CH, (g) + 2 0, (g) → Co, (g) + 2 H,O (g) + 890 kJarrow_forwardCalculate ΔG for the following equation: SO2(g)+2H2(g)→S(s)+2H2O(g) Given: ΔGf of SO2(g) = -300.4 kj/mol ΔGf of H2(g) = 0 kj/mol ΔGf of S (s) = 0 kj/mol ΔGf of H2O (g) = -228.57 kj/molarrow_forwardCalculate the ΔHo (in kJ) for the hypothetical reaction: 2X2D (g) + 3M2 (g) → 2X2M (l) + 2DM2 (g) ΔHof for X2D (g) = -22.4 kJ/mol ΔHof for DM2 (g) = -293 kJ/mol ΔHof for X2M (l) = -285.3 kJ/mol ΔHof for M2 (g) = 0 kJ/molarrow_forward
- For the following reaction, AGºrxn = -12.17 kJ/mol at 1700 C. 2 A(g) + B(g) 2 C(g) a. What is the free energy change (AG) under conditions when 2.00 mol of A, 1.40 mol of B, and 0.40 mol of C are added to a 4.00 liter flask at 1700 C? b. Which direction will the reaction proceed in?arrow_forwardAccording to the following reaction, how much energy is evolved during the reaction of 53.2 g Fe2O3 and 7.00 g of CO? 3 Fe2O3(g) + CO(g)→→ 2 Fe3O4(g) + CO2(g) ΔHo = -48.5 kJ 16.2 kJ 5.38 kJ 12.1 kJ 17.4 kJ 48.5 kJarrow_forwardConsider the following general equation for a chemical reaction. A(g) + B(g) → C(g) + D(g) ∆H° reaction = -10 kJ (a) Describe the two factors that determine whether a collision between molecules of A and B results in a reaction. (b) How would a decrease in temperature affect the rate of the reaction shown above? Explain your answer. (c) Explain why a catalyst increases the rate of a reaction but does not change the value of the equilibrium constant for that reaction. NOTE: Please briefly explain and answer a,b and c. Thank you.arrow_forward
- 21. Solid ammonium carbamate, NH4CO₂NH2, decomposes to ammonia and carbon dioxide when it sublimes: NH4CO₂NH2 (s) = 2NH3(g) +CO2 (g) Imagine a sample of ammonium carbamate is allowed to decompose in an evacuated sealed container at 25°C (evacuated means no gas components at the start of the reaction). The decomposition is endothermic, and the Kp at 25°C is 2.3 x104. Tuming a. What are the partial pressures of NH3 and CO₂ at equilibrium? What is the total pressure in the container at equilibrium? Assume the mixture is ideal.arrow_forwardThe balanced equations for two reactions are shown. (1) CH4 + N2 + H2 → CH3N + NH3 (2) CH4 + I2 → CH3I + HI Which statement best explains why reaction 1 requires a greater input of energy than reaction 2? The number of reactants in reaction 1 is greater than the number of reactants in reaction 2. The number of bonds in the reactants in reaction 1 is greater than the number of bonds in the reactants in reaction 2. The bond energy of the products in reaction 1 is less than the bond energy of the products in reaction 2 The bond energy of the reactants in reaction 1 is greater than the bond energy of the reactants in reaction 2.arrow_forward5. For the species in the reaction: 2Co(s) + H2(g) 8PF3(g) → 2HCo(PF3)4(l), which component is ΔH0f equal zero?arrow_forward
- Chemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningGeneral Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningIntroduction to General, Organic and BiochemistryChemistryISBN:9781285869759Author:Frederick A. Bettelheim, William H. Brown, Mary K. Campbell, Shawn O. Farrell, Omar TorresPublisher:Cengage Learning
- Introductory Chemistry: A FoundationChemistryISBN:9781337399425Author:Steven S. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781133949640Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage LearningChemistry & Chemical ReactivityChemistryISBN:9781337399074Author:John C. Kotz, Paul M. Treichel, John Townsend, David TreichelPublisher:Cengage Learning