Concept explainers
Interpretation:
The emf of theconcentration cell at
Concept introduction:
The solubility product,
Here,
The standard reduction potential of a galvanic cell may be calculated in terms of the standard reduction potential of cathode and anode as the relation mentioned below.
Here,
Reaction quotient is the ratio of the molar concentration of the ions in the products to that of the reactants, raised to the power of their stoichiometric coefficients.
According to the Nernst equation, the relation between emf, standard cell potential, and reaction quotient, at
Here,
Want to see the full answer?
Check out a sample textbook solutionChapter 19 Solutions
Chemistry
- Calculate the standard cell potential of the following cell at 25C. Sn(s)Sn2+(aq)I2(aq)I(aq)arrow_forwardAn alloy made up of tin and copper is prepared by simultaneously electroplating the two metals from a solution containing Sn(NO3)2 and Cu(NO3)2.If 20.0% of the total current is used to plate tin, while 80.0% is used to plate copper, what is the percent composition of the alloy?arrow_forwardCalculate the cell potential of a cell operating with the following reaction at 25C, in which [MnO4] = 0.010 M, [Br] = 0.010 M. [Mn2] = 0.15 M, and [H] = 1.0 M. 2MNO4(aq)+10Br(aq)+16H+(aq)2MN2(aq)+5Br2(l)+8H2O(l)arrow_forward
- What is the voltage of a concentration cell of Fe2+ ions where the concentrations are 0.0025 and 0.750 M? What is the spontaneous reaction?arrow_forwardCalculate the cell potential of a cell operating with the following reaction at 25C, in which [Cr2O32] = 0.020 M, [I] = 0.015 M, [Cr3+] = 0.40 M, and [H+] = 0.60 M. Cr2O72(aq)+6I(aq)+14H+(aq)2Cr3+(aq)+3I2(s)+7H2O(l)arrow_forwardWhat is the cell potential (Ecell) of a spontaneous cell that is run at 25C and contains [Cr3+] = 0.10 M and [Ag+] = 1.0 104 M?arrow_forward
- Calculate the standard potential for the half-reaction BiOCl(s)+2H++3eBi(s)+Cl+H2O given that Ksp for BiOCl has a value of 8.1 10-19.arrow_forwardWhat is the standard cell potential you would obtain from a cell at 25C using an electrode in which I(aq) is in contact with I2(s) and an electrode in which a chromium strip dips into a solution of Cr3(aq)?arrow_forwardConsider a concentration cell that has both electrodes made of some metal M. Solution A in one compartment of the cell contains 1.0 M M2+. Solution B in the other cell compartment has a volume of 1.00 L. At the beginning of the experiment 0.0100 mole of M(NO3)2 and 0.0100 mole of Na2SO4 are dissolved in solution B (ignore volume changes), where the reaction M2+(aq)+SO42(aq)MSO4(s) occurs. For this reaction equilibrium is rapidly established, whereupon the cell potential is found to be 0.44 V at 25C. Assume that the process M2++2eM has a standard reduction potential of 0.31 V and that no other redox process occurs in the cell. Calculate the value of Ksp for MSO4(s) at 25C.arrow_forward
- What is the cell potential of the following cell at 25C? Ni(s)Ni2+(1.0M)Sn2(1.5104M)Sn(s)arrow_forwardThe free energy change for the following reaction at 25 °C, when [Cd²+] = 2.22×10³ M and [I,] = 1.13 M, is 196 kJ: Cd2+(2.22×10-3 M) + 21(aq)–→ Cd(s) + I2(1.13 M) AG = 196 kJ What is the cell potential for the reaction as written under these conditions? Answer: V Would this reaction be spontaneous in the forward or the reverse direction?arrow_forward(C) Iron (D) Mercury -0. What is the standard reduction potential for Cr2+ (aq) to Cr(s)? Half-Reaction Cr³+ (aq) + 3 e → Cr(s) Cr³+ (aq) + e→Cr²+ (aq) (A) -0.23 V (C) -1.23 V Eº, V -0.73 -0.50 (B) -0.85 V (D) -1.69 V 11. What is observed if a piece of lead is placed in an aqueous solution of Cu(NO3)2? Half-Reaction Eº, Varrow_forward
- General Chemistry - Standalone book (MindTap Cour...ChemistryISBN:9781305580343Author:Steven D. Gammon, Ebbing, Darrell Ebbing, Steven D., Darrell; Gammon, Darrell Ebbing; Steven D. Gammon, Darrell D.; Gammon, Ebbing; Steven D. Gammon; DarrellPublisher:Cengage LearningChemistry: The Molecular ScienceChemistryISBN:9781285199047Author:John W. Moore, Conrad L. StanitskiPublisher:Cengage LearningChemistry: Principles and ReactionsChemistryISBN:9781305079373Author:William L. Masterton, Cecile N. HurleyPublisher:Cengage Learning
- ChemistryChemistryISBN:9781305957404Author:Steven S. Zumdahl, Susan A. Zumdahl, Donald J. DeCostePublisher:Cengage LearningChemistry: An Atoms First ApproachChemistryISBN:9781305079243Author:Steven S. Zumdahl, Susan A. ZumdahlPublisher:Cengage Learning